On Target 5HT6R_HUMAN 0.39222616/CHEMBL4471755
For the given ligand Trequinsin, we have found in our database that, being scored 0.39222616, the most similar ligand is CHEMBL4471755. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL4471755 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccc(-c2c3n(c(=O)n(CCCCN4CCCC(c5c[nH]c6ccc(OC)cc56)C4)c2=O)CCCC3)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00000002 01000809 2010110a 43850710 240e5502 00006448 070c2800 20000400 06700980 900918e0 0c30800c 50038800 18009816 02f00800 212200e1 800c100c 00820000 86808000 04600408 40020a01 c0000500 98208018 21804041 91700510 00842001 c0080201 28120320 100400d0 04014205 02460002 402c0204 200026a8 |