On Target 5HT2C_HUMAN 0.37301588/CHEMBL4092042
For the given ligand Trequinsin, we have found in our database that, being scored 0.37301588, the most similar ligand is CHEMBL4092042. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL4092042 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccc2c(c1)-c1c(cnn1C[C@H](C)N)C2 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00006004 42000009 a0100188 c101061a 21081000 08012102 02442400 01000000 00000000 000808c0 08008008 6001a000 00001012 20a00000 21820801 000ca00e 000340c0 86000000 04c80002 00223200 80100000 38050410 b1804811 0252401c 08810000 c0000000 10120000 50000070 02004284 40060003 20481240 00000420 |