On Target GRM4_HUMAN 0.312/CHEMBL2023471
For the given ligand Trequinsin, we have found in our database that, being scored 0.312, the most similar ligand is CHEMBL2023471. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL2023471 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CC(=O)N1CCN(CCOc2ccc3c(-c4cnn(-c5ccccc5)c4)ccnc3c2)CC1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 04002006 40002a08 20004188 04010612 200c1080 00004008 06000000 00001008 00000100 000108c0 01200004 60008000 80808802 00402000 01121041 800c000c 10020040 82400004 04680100 00261200 40000040 38078628 32800820 83400018 00000001 80000000 00000000 00000041 0c004280 10460009 40040000 802006a0 |