On Target CCR2_HUMAN 0.33898306/CHEMBL238731
For the given ligand Trequinsin, we have found in our database that, being scored 0.33898306, the most similar ligand is CHEMBL238731. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL238731 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COC(=O)[C@H](CCCNC(=N)N)NC(=O)CCNc1cc(-c2cc(Cl)cc(Cl)c2)nn1-c1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0001a007 01005609 e0100100 00810f00 21080080 00006022 04c00000 20003000 00200314 100109f2 09200004 7003b810 0f009836 01000400 802b1040 001c604c 10860000 02800000 04400010 00226201 60100000 18059f2c 33800800 8350c018 00042200 80080000 74970200 100008e1 0400431c 00460019 e00e4600 900226e0 |