On Target MC5R_HUMAN 0.31164384/CHEMBL441738
For the given ligand Trequinsin, we have found in our database that, being scored 0.31164384, the most similar ligand is CHEMBL441738. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL441738 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CCCC[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(C)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(N)=O)C(C)C |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 04030002 01007a08 20100100 45810e10 041c12c0 00000010 02002020 2000200c 00600b80 000b0ac2 28308004 5003b800 1e00983a 01502801 811a0040 001c000c 10000000 0e000000 00e02418 40020201 60000d00 38258e38 23800083 93500018 00043801 80000200 48120000 10000100 0c000014 0046000b e00c4200 20802e20 |