On Target CCR4_HUMAN 0.224/CHEMBL208249
For the given ligand test, we have found in our database that, being scored 0.224, the most similar ligand is CHEMBL208249. Check out the elaboration below.
| test (Given Ligand) | CHEMBL208249 (Similar Ligand) |
|---|---|
| CCCCCc1cccc(C)c1 | CC(C)(C)c1csc(Nc2cccc3CCCCc23)n1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00000000 02000000 00002000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000002 00020002 00000000 00000400 | 00030602 01000000 00000902 00010200 09000080 00000000 01000100 10028009 00404b00 000c0850 08308a04 50008800 00000008 00200801 00022040 000c0004 00048200 12004080 08402018 30a04001 44000100 08c02080 23004800 40410010 00045080 8c000401 00200000 00011484 0050800e 040e2002 e0000080 24010402 |