On Target GASR_HUMAN 0.26436782/CHEMBL38874
For the given ligand test, we have found in our database that, being scored 0.26436782, the most similar ligand is CHEMBL38874. Check out the elaboration below.
| test (Given Ligand) | CHEMBL38874 (Similar Ligand) |
|---|---|
| CCCCCc1cccc(C)c1 | C[C@@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)NCC(=O)N(C)[C@@H](Cc2ccccc2)C(=O)NCCO |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00000000 02000000 00002000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000002 00020002 00000000 00000400 | 00000000 00007208 20100100 04010600 00000080 00000000 02000000 2000000c 00000880 000808c0 08300000 4000b000 06008002 00002001 80180000 000c0008 10000000 02000000 00000008 00020201 00000100 38200600 02000003 83400018 00000800 80000000 00120000 10000000 0c000000 0006000b 20004000 00000600 |