On Target AGTR2_HUMAN 0.24752475/CHEMBL128416
For the given ligand test, we have found in our database that, being scored 0.24752475, the most similar ligand is CHEMBL128416. Check out the elaboration below.
| test (Given Ligand) | CHEMBL128416 (Similar Ligand) |
|---|---|
| CCCCCc1cccc(C)c1 | OC(=O)C1Cc2ccccc2CN1C(=O)C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00000000 02000000 00002000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000002 00020002 00000000 00000400 | 00008008 00805000 00100100 10010600 000000a0 00000000 01001000 03001004 00000880 00080840 08300000 4000b000 07008882 00200000 c0080480 00080008 10000200 02000020 00400008 00000201 80020100 18208e00 03004040 81400018 00000800 e0000001 00004000 c0000000 04000180 00860003 20046000 00002600 |