On Target GRM4_HUMAN 0.18045112/CHEMBL3797923
For the given ligand test, we have found in our database that, being scored 0.18045112, the most similar ligand is CHEMBL3797923. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3797923 (Similar Ligand) |
|---|---|
| CCCCCc1cccc(C)c1 | Nc1cccnc1C(=O)Nc2ccc(N3CC(Cc4ccccc4)CC3=O)c(Cl)c2 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00000000 02000000 00002000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000002 00020002 00000000 00000400 | 0003c002 01a01a00 00104102 11010e20 20060020 00112010 08000000 2a001001 00100800 000808c0 08390004 4001d800 06008806 00300001 00020040 02040104 00040000 0a000008 08200000 00004201 40100100 18068700 20812000 0051001c 00102000 80000401 00000040 90000080 00008104 0046000b 80040000 40c24680 |