On Target MC5R_HUMAN 0.26262626/CHEMBL3958082
For the given ligand test, we have found in our database that, being scored 0.26262626, the most similar ligand is CHEMBL3958082. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3958082 (Similar Ligand) |
|---|---|
| CCCCCc1cccc(C)c1 | NCCC[C@H]1N[C@@H](CNC(=O)c2ccc3ccccc3c2)CCN(C(C4CCCCC4)c5ccccc5)C1=O |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00000000 02000000 00002000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000002 00020002 00000000 00000400 | 00010000 01803c00 00100102 04010600 00000000 00000000 00000000 22001008 00200800 000909e0 08300000 4003b000 06008812 00202001 80000400 00000000 00000000 02000000 02002000 00000201 88000100 380e8638 00000003 0250001c 00000000 c0000000 00000000 90000000 08000102 00060013 a0064000 00002600 |