On Target DRD2_HUMAN 0.3590604/CHEMBL1258949
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.3590604, the most similar ligand is CHEMBL1258949. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL1258949 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | Cc1ncoc1c2nnc(SCCCN3CCC4(CCc5cc(F)ccc45)C3)n2C |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 00010006 01111319 c0180922 02118650 21000021 08108016 00800500 31002009 00124988 800868d4 09308108 50818912 03010402 00641001 80020001 020ea00c 04008200 0601a880 80402001 42340251 c4300100 18200018 23004200 8558801c 22040002 e1104801 94200000 18040171 04180006 0006902a 800c0080 01012644 |