On Target DRD1_HUMAN 0.31178707/CHEMBL3099235
For the given ligand ticagrelor_Y, we have found in our database that, being scored 0.31178707, the most similar ligand is CHEMBL3099235. Check out the elaboration below.
| ticagrelor_Y (Given Ligand) | CHEMBL3099235 (Similar Ligand) |
|---|---|
| CCCSc5nc(N[C@@H]1C[C@H]1c2ccc(F)c(F)c2)c4nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c4n5 | CCCN1C[C@@H](Cn2cncn2)O[C@@H]3Cc4c(O)cccc4C[C@@H]13 |
|
|
|
|
|
|
| 0001400b a3000b18 e01001a0 0a192720 20380060 0000e014 04008100 10102902 00020900 118868c0 0930000c 50019900 04011024 038c1100 70420281 100ed00c 04a41080 06014088 99c00020 00362041 80120120 18340050 27805044 8dc80015 00202c02 90000200 90040208 100050b1 0e300208 0146800a c0001000 0d2186c0 | 00000004 43000608 e0110502 80010700 001800e0 c0008004 02001000 20000241 00200980 010819c0 08300008 40808140 00000002 01280000 002c1088 020c310c 18308200 02000000 14402000 00221201 80010120 18200040 33004040 8d400010 30000400 80000001 00000000 11000021 04000202 0006c81a 80000000 00002f40 |