On Target HRH2_HUMAN 0.36725664/CHEMBL1086105
For the given ligand chenyan1, we have found in our database that, being scored 0.36725664, the most similar ligand is CHEMBL1086105. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL1086105 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | Cc1cc(OCCCN2CCc3nc[nH]c3C2)ccc1c4nc5c(C)c(F)ccc5[nH]4 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 1400000a 40000808 20100108 13050e10 04041060 02104030 02046000 08083001 00400180 10490a50 61218004 40008800 018000a2 00709080 01020441 020c200d 00220200 0a002022 80a80000 40420200 41020800 38210820 218050a0 10400010 01041001 81000600 00024040 80000003 04000204 00478c00 60000800 a00022e0 |