On Target DRD1_HUMAN 0.42079207/CHEMBL3671296
For the given ligand chenyan1, we have found in our database that, being scored 0.42079207, the most similar ligand is CHEMBL3671296. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL3671296 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | Cc1cc(Oc2nccc3n[nH]cc23)ccc1n4c(C)nc5cnccc45 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 0000000a 40800218 20004108 10010600 800c1060 0000c100 06009400 00401008 10400100 000018d0 0100800c 40018000 00001806 00800200 210e03c1 021c000c 18000008 02000000 00682000 00260200 c5420000 1c008060 21800841 81400000 00102000 c0000040 00048000 10200000 040002a4 00460808 40040400 074044a0 |