On Target HRH4_HUMAN 0.49162012/CHEMBL220933
For the given ligand chenyan1, we have found in our database that, being scored 0.49162012, the most similar ligand is CHEMBL220933. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL220933 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | CN1CCN(CCCOc2ccc(c(Cl)c2)c3nc4c(C)cc(C)cc4[nH]3)CC1 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 04008002 00000808 20100108 14050610 00041061 02004000 92040000 08080000 00000100 10000851 01208004 40008800 02800026 0040a002 01020043 020c200c 00200000 02002004 00a00000 40420200 41000000 38000120 218000a1 02400010 00042001 80000200 00020040 00000000 0840020c 00460c00 40000800 000202e0 |