On Target OPRX_HUMAN 0.3970588/CHEMBL3942616
For the given ligand C64, we have found in our database that, being scored 0.3970588, the most similar ligand is CHEMBL3942616. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL3942616 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CN(C)C1(CCC(C)(CNS(=O)(=O)c2ccc(Cl)cc2)CC1)c3ccccc3 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00008010 01800200 01100102 01b10600 00080000 10000000 00000000 02001000 00000800 004808c0 08302000 60018800 02000804 00200001 80600000 00000000 00002000 02000000 02402000 00006401 80000100 18008130 00000000 18500018 02002000 80000004 10000000 9000000c 00000502 20060002 00060000 00030670 |