On Target MC5R_HUMAN 0.35643566/CHEMBL2113139
For the given ligand C64, we have found in our database that, being scored 0.35643566, the most similar ligand is CHEMBL2113139. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL2113139 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | Clc1ccc(C[C@@H](NC(=O)[C@H]2Cc3ccccc3CN2)C(=O)N4CCN(CC4)c5cccc6CCN(Cc56)S(=O)(=O)c7ccccc7)cc1 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 0000c05a 20803200 41180120 15b10600 00080020 00100040 05010001 2200180c 00400880 a0491ad0 08b02004 6000b800 06008827 00603001 80220440 02040000 00242000 03100022 08400008 00806601 c4120100 38208700 20004023 9b40001a 02042800 c2000005 40054000 9000108c 0c408500 2086000b 20044000 40032760 |