On Target EDNRA_HUMAN 0.20454545/CHEMBL414408
For the given ligand BP, we have found in our database that, being scored 0.20454545, the most similar ligand is CHEMBL414408. Check out the elaboration below.
| BP (Given Ligand) | CHEMBL414408 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | Cc1ccc(-c2ccc3c(c2)C(=O)c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@H]32)cc1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00052000 01000800 00000102 00010200 00280001 00008002 01001400 01000001 04000900 00080840 08100000 40009a00 04008008 00a00010 00000020 08080008 00020000 02001000 04502008 10000001 00400100 08120a40 11404040 00400814 00000800 a0000081 00000000 40000041 12004082 00020002 80000000 00400500 |