On Target NK2R_HUMAN 0.19354838/CHEMBL17157
For the given ligand BP, we have found in our database that, being scored 0.19354838, the most similar ligand is CHEMBL17157. Check out the elaboration below.
| BP (Given Ligand) | CHEMBL17157 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | CC(C)(C)c1ccc(C(O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00000000 01000000 00100102 00050600 00100000 00004000 00000000 21000000 00100900 000808c0 08300000 50018800 00000002 00200000 00000000 00080008 00000000 02000000 00400000 00000201 00000100 18000020 01000000 00500010 00000000 a0000000 00000000 50000000 00000080 00060002 40000000 00002e00 |