On Target CCR1_HUMAN 0.21428572/CHEMBL2205805
For the given ligand BP, we have found in our database that, being scored 0.21428572, the most similar ligand is CHEMBL2205805. Check out the elaboration below.
| BP (Given Ligand) | CHEMBL2205805 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | Clc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00012202 00000000 00004100 10800200 000c00e1 00000000 00000000 00080040 00000100 10000040 00000004 40000800 02000800 00080000 80020000 020c0004 00020000 12002008 04200000 10406000 40000000 08008900 31800000 00400000 00000000 80000000 00000040 00001040 0000400c 00220400 40000800 00420000 |