On Target ACM3_HUMAN 0.30508474/CHEMBL494410
For the given ligand BP, we have found in our database that, being scored 0.30508474, the most similar ligand is CHEMBL494410. Check out the elaboration below.
| BP (Given Ligand) | CHEMBL494410 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | Cc1cccc(C(=O)NCc2cccc(-c3cccc(CN4CCNCC4)c3)c2)c1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00002000 00800800 00000100 04010600 00000001 04000000 10000000 02001000 00000000 00010840 00200000 40008000 00008802 00002000 00000400 08000008 00022000 02001000 04000000 00000000 80000000 28028600 10000020 0240000c 00000000 c0000000 08000000 80000041 08004100 00060001 80040000 00000200 |