On Target GRM4_HUMAN 0.17777778/CHEMBL2022867
For the given ligand BP, we have found in our database that, being scored 0.17777778, the most similar ligand is CHEMBL2022867. Check out the elaboration below.
| BP (Given Ligand) | CHEMBL2022867 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | c1ccc(-n2cc(-c3ccnc4ccccc34)cn2)cc1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00000006 40000a08 20004180 00010610 200c0000 00004008 00000000 00001000 00000100 000108c0 01000004 60008000 80000800 00400000 00020040 800c000c 00020040 82400000 04680100 00221000 40000040 18038028 20800800 83400010 00000001 80000000 00000000 00000040 04004080 10460009 40040000 800004a0 |