On Target EDNRA_HUMAN 0.5078125/CHEMBL432974
For the given ligand Tramadol, we have found in our database that, being scored 0.5078125, the most similar ligand is CHEMBL432974. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL432974 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | CCCCN(CCCC)C(=O)CN1C[C@@H]([C@H]([C@@H]1CC(C)(C)CCC)C(=O)O)c2ccc3OCOc3c2 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00030000 43001208 2010010a 04010600 00181000 c0000010 02040000 20000000 00200880 000808c0 48300000 4001b000 0e00c00a 20a02000 81000001 002c8008 00000000 02000000 00c82018 00020201 00040300 38240e10 010000c1 83500018 40001801 80000000 00120000 30000000 0d000202 0006000b 00024000 00812e00 |