On Target GRM6_HUMAN 0.38317758/CHEMBL275079
For the given ligand Cocaine, we have found in our database that, being scored 0.38317758, the most similar ligand is CHEMBL275079. Check out the elaboration below.
| Cocaine (Given Ligand) | CHEMBL275079 (Similar Ligand) |
|---|---|
| COC(=O)C2C(OC(=O)c1ccccc1)CC3CCC2N3C | N[C@]1(CO[C@H]2[C@@H]([C@@H]12)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00070040 01000000 00000000 80010500 803c0040 00200000 00000000 00000000 00000000 01020080 00000000 4001b000 14008038 03800000 00081000 00081008 00a00000 00000100 11c02000 00000001 00000020 10000a00 03000000 00000010 10000400 00000000 00000200 00000000 00000200 00040000 00000000 00000000 |