On Target GASR_HUMAN 0.40983605/CHEMBL1171596
For the given ligand Tramadol, we have found in our database that, being scored 0.40983605, the most similar ligand is CHEMBL1171596. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL1171596 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | CCCC[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc2ccccc2)C(=O)N |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00070000 01003208 20100100 04010600 00100000 00000000 02000000 2000000c 00000880 000808c0 08300000 4001b000 0e00800a 00002001 80000000 000c0008 00000000 02000001 00c02018 00020201 00000100 38340e10 01000083 83500018 00001801 80000000 00120000 10000000 0c000002 0006000b 20004000 00802e00 |