On Target 5HT1F_HUMAN 0.3846154/CHEMBL104374
For the given ligand Tramadol, we have found in our database that, being scored 0.3846154, the most similar ligand is CHEMBL104374. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL104374 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000002 03800a18 20104109 40810610 800c1240 00000100 0608a000 2000c000 00400800 000800c0 08300004 50018000 08000806 00400800 61040301 0014000c 18000000 02000000 00600400 00020201 40020100 18008008 21800040 80500010 00042000 80000000 08008000 10002004 00000200 0006000a 00040200 04000620 |