On Target 5HT1E_HUMAN 0.30252102/CHEMBL2391541
For the given ligand Tramadol, we have found in our database that, being scored 0.30252102, the most similar ligand is CHEMBL2391541. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL2391541 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1ccc2[nH]cc(CCN(CC=C)CC=C)c2c1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000002 00000808 20100108 41010610 00041000 00000000 060c2000 00000400 00400080 00090840 08200004 40008000 10000806 00410000 01000041 0004000c 00000000 02000100 00200400 00020200 40000000 18208008 20800000 91400010 00042000 80000000 081a0000 00000020 04000200 00060002 04040200 02000620 |