On Target CXCR1_HUMAN 0.26881722/CHEMBL490688
For the given ligand Tramadol, we have found in our database that, being scored 0.26881722, the most similar ligand is CHEMBL490688. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL490688 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | CN(C)C(=O)c1cccc(Nc2nsnc2N[C@@H](c3ccc4OCCOc4c3)C(C)(C)C)c1O |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 14010002 46010888 20100109 01210e20 20001000 48020010 02040210 0a101600 00803900 00080851 88352004 4000c880 0a80c812 20100081 01240041 100ce00c 00040000 1a005000 08080012 10024201 41100100 18228f00 25010010 08458015 00840002 80800480 20320000 80800090 20408308 1006000b c6041000 00010600 |