On Target 5HT4R_HUMAN 0.60330576/CHEMBL56564
For the given ligand Cocaine, we have found in our database that, being scored 0.60330576, the most similar ligand is CHEMBL56564. Check out the elaboration below.
| Cocaine (Given Ligand) | CHEMBL56564 (Similar Ligand) |
|---|---|
| COC(=O)C2C(OC(=O)c1ccccc1)CC3CCC2N3C | CN1[C@@H]2CC[C@H]1C[C@H](C2)OC(=O)c3c[nH]c4ccccc34 |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00000002 01801800 00100100 00010710 000c1010 0000c010 00000000 20000004 10400100 000008c0 00200004 50018000 00008802 00c90000 00000040 020c100c 00a20001 02000000 00e12000 00000201 c0000020 18028a38 21800080 8050001c 00040401 80002000 08080000 10001000 04000200 00060006 c0060200 02002220 |