On Target ADRB2_HUMAN 0.42328042/CHEMBL236251
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.42328042, the most similar ligand is CHEMBL236251. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL236251 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | C[C@H](Cc1ccc2[nH]c(cc2c1)C(=O)NCC3CCC3)NC[C@H](O)c4ccc(O)c(CO)c4 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 00000002 0100d808 20100100 10010e00 000410a1 00104000 02000000 22003801 00000980 000808c0 a8390004 40018000 00008802 00500010 000a0440 020c210c 10000000 02000006 00200000 40020201 40000100 18278628 22802000 8150001c 00100000 c0000000 00520040 90000000 04400104 00060003 e0040200 00006600 |