On Target GRM7_HUMAN 0.3773585/CHEMBL3560146
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.3773585, the most similar ligand is CHEMBL3560146. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL3560146 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | COC(=O)c1ccc(cc1)n2c(C)cc(C(=O)COc3ccc(NC(=O)C)cc3)c2C |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 0400500a 00801a08 20080108 d0090610 00005060 0200c000 02002000 0000104c 00500100 000838d0 002c0004 4001c000 80808822 00318200 010a00c1 0a0c200c 18060000 82800004 0c200500 00020000 c4100000 18068e20 21806000 8140001c 00042000 c0002040 08040008 00001884 04008204 1006084b c0040200 00000220 |