On Target OPRX_HUMAN 0.5531915/CHEMBL3349268
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.5531915, the most similar ligand is CHEMBL3349268. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL3349268 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CC(=O)NC[C@]1(C[C@H]2CC[C@@H](C1)N2C(c3ccccc3Cl)c4ccccc4Cl)c5ncccc5CN6CCCCC6 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 1400800a 01009200 00104122 10010610 00041020 00000010 01004020 2300100c 00200880 80080ac0 09308004 50838800 02008886 00200000 01020420 02040004 00020200 0e000004 00202008 00000201 60120d00 18248f10 20804000 81500018 00043000 e0000201 08004040 d0001180 04400186 0186000b 2c060000 a0022600 |