On Target OPRD_HUMAN 0.5153374/CHEMBL493973
For the given ligand Captagon, we have found in our database that, being scored 0.5153374, the most similar ligand is CHEMBL493973. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL493973 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | Nc1ccnc(c1)N2CCC(CC2)N3C(=O)N(Cc4ccccc4)c5cccnc35 |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 00004022 01800e00 00184100 00010700 200c0048 0000e080 00008000 00101000 04700100 a00009e0 0c20800c 50018000 00009802 01c40000 003e00c0 000c100c 08940000 02004000 08600000 00a00201 e0100000 1c008070 21800841 81700014 00080000 c0100000 20008480 10040080 0400c018 00460818 c00c1000 020006c0 |