On Target GASR_HUMAN 0.2413793/CHEMBL294542
For the given ligand Aspirin, we have found in our database that, being scored 0.2413793, the most similar ligand is CHEMBL294542. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL294542 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CN([C@@H](Cc1ccccc1)C(=O)N)C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCNC(=O)c2ccc3cc(OC(=O)C)ccc3c2)NC(=O)[C@H](Cc4c[nH]c5ccccc45)NC(=O)OC(C)(C)C |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04070002 01403a08 20100108 45810610 00141200 00018000 02002000 2200100c 00c00a80 000908c0 08300004 4001b000 1e80880a 00402801 81010441 001e000c 00020000 02080001 00e02c18 00020201 40000100 38368e38 31800083 9350001c 00043801 c0000002 08000000 90200020 0c000302 0006000b a0044200 10802e20 |