On Target CCR5_HUMAN 0.3617021/CHEMBL234461
For the given ligand Aspirin, we have found in our database that, being scored 0.3617021, the most similar ligand is CHEMBL234461. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL234461 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CN(C)Cc1cc(Br)ccc1OCc2ccc(Cl)cc2 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 0400c000 20008008 20000108 00010600 00001000 00004100 02000000 02001400 40000100 00000840 08200000 c0008800 02800896 00010000 01000101 02082008 00000000 02008000 00000000 00020000 00000040 08008120 00008000 00c01000 00006000 80002000 00460000 80000000 00000300 00060000 44040008 08020200 |