On Target CCR2_HUMAN 0.4/CHEMBL1171788
For the given ligand Aspirin, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL1171788. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1171788 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CS(=O)(=O)Nc1cc(Cl)ccc1Oc2ccccc2C(=O)O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00008002 00000828 2000010a 00310200 80001000 00024000 0a000000 00000800 00004104 00000840 00002004 40008800 02008406 00000001 81080041 000a6028 00080000 0a000400 00002000 01024000 41400000 08020b20 20000000 00400004 80002080 80000000 10100800 0022000c 00000320 00060000 c1025400 00030060 |