On Target CCR4_HUMAN 0.42222223/CHEMBL395680
For the given ligand fentanyl, we have found in our database that, being scored 0.42222223, the most similar ligand is CHEMBL395680. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL395680 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CN(C1CCN(CCc2ccccc2N)CC1)C(=O)[C@@H]3CCCN3S(=O)(=O)c4ccc5c(Cl)cccc5c4 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00018092 01801400 01100100 05b10600 00088000 00000010 00020000 20000000 00000080 004809e0 08202004 7001b800 06008016 00002001 80620040 00008000 00002000 02000000 00600010 00006601 c0040000 38280729 20000001 bb500038 02003000 80000004 00000000 1000000c 0c000400 20060013 00004002 20032670 |