On Target NPY4R_HUMAN 0.50666666/CHEMBL3559801
For the given ligand Oseltamivir, we have found in our database that, being scored 0.50666666, the most similar ligand is CHEMBL3559801. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3559801 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | CC(C)(C)c1ccc(OC2CCCCC2O)cc1 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 04000000 01000008 20000108 00010300 00081000 02000000 02040000 00000000 00000000 00080840 08000000 40008000 00800002 00800000 11200001 00082008 00800000 02000000 02402000 00020001 00000000 08000000 05000000 08400010 00000000 80000000 00120000 00800000 00000200 00020002 00000000 00000400 |