On Target ADA2B_HUMAN 0.45054945/CHEMBL3735756
For the given ligand Oseltamivir, we have found in our database that, being scored 0.45054945, the most similar ligand is CHEMBL3735756. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3735756 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1ccc(CCN(CCCc2ccccc2)CCc3ccc4OCOc4c3)cc1OC |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00000000 42000208 20100108 00010600 00001000 80000000 02040000 20000000 00200880 000808c0 48300000 40008000 00004002 20000000 01000001 00248008 00000000 02000000 00080000 00020201 00040300 18200000 00000000 81400010 40000000 80000000 00120000 30000000 05000200 0006000a 00000000 00012600 |