On Target 5HT1F_HUMAN 0.2877698/CHEMBL3616488
For the given ligand Oseltamivir, we have found in our database that, being scored 0.2877698, the most similar ligand is CHEMBL3616488. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3616488 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1c(NC(=O)c2ccc(F)cc2)cccc1C(=O)C3CCN(C)CC3 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00024002 01000808 6010010a 02010600 84001000 00020010 02000000 22001200 00500800 000808d0 08380004 5001d040 04008802 00301800 01200041 10006408 00040000 06000100 08000000 00120201 44100100 18028600 20012000 00508414 00040000 c0000000 20000840 90000081 20408300 0006c003 80040000 00800600 |