On Target GRM1_HUMAN 0.49425286/CHEMBL254372
For the given ligand Oseltamivir, we have found in our database that, being scored 0.49425286, the most similar ligand is CHEMBL254372. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL254372 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | C=C1C[C@@H]2COC(=O)[C@]2(Cc3ccc4ccccc4c3)C1 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00050040 81000008 00000102 80010300 00080000 00000000 00000000 00000400 00000800 00188848 08100000 40009000 04008008 00a00000 00080400 00081008 00820000 02000000 00402008 00000001 00000120 08000a08 01000040 00400010 00000c00 80002000 00000000 80000000 00000202 81020002 24020000 00000400 |