On Target DRD5_HUMAN 0.46067417/CHEMBL231171
For the given ligand Oseltamivir, we have found in our database that, being scored 0.46067417, the most similar ligand is CHEMBL231171. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL231171 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1ccc2Cc3ccccc3CCCN(C)CCCc2c1 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00000000 42000208 20100108 00010600 00001000 40000002 02040400 21000001 04000800 000808c0 08300000 40008000 00000002 20200000 01000001 02040008 00000000 02000000 00180000 00020201 00000100 18000000 00004000 00400010 00000000 a0000001 00120000 50000000 02000280 0006000a 00000000 00002600 |