On Target 5HT4R_HUMAN 0.4107143/CHEMBL80015
For the given ligand Oseltamivir, we have found in our database that, being scored 0.4107143, the most similar ligand is CHEMBL80015. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL80015 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1cc(N)c(Cl)cc1C(=O)CCC2CCN(C)CC2 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00018002 85000808 2010010a c0010600 00001000 00020000 06000000 20000200 00000800 000808c0 08300004 50019840 0600800e 08200000 81000041 00002008 00000000 02000400 00002000 00020601 40000100 18020310 20000000 00540414 00002000 c0000400 00100800 10000000 00000302 00064802 80020000 00020600 |