On Target NK2R_HUMAN 0.03809524/CHEMBL9960
For the given ligand S protein, we have found in our database that, being scored 0.03809524, the most similar ligand is CHEMBL9960. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL9960 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | CC[C@H](NC(=O)c1cc(nc2ccccc12)c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00002002 00801800 00104100 10010600 00040020 04000000 10000000 02081004 00000800 10080840 08300004 40008000 80008802 00408000 00020440 0a04000c 00022008 02003000 04200000 00400201 c0000100 18028608 30800000 8040001c 00004000 c0000000 08000040 80000041 10004104 00060403 a0048800 00000620 |