On Target 5HT2C_HUMAN 0.07317073/CHEMBL452719
For the given ligand S protein, we have found in our database that, being scored 0.07317073, the most similar ligand is CHEMBL452719. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL452719 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | Cl.NC[C@H]1C[C@@H]1c2ccccc2 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00000000 01000200 00000102 00010600 00000000 00000000 00000000 00000000 00100800 000808c0 08100000 40018000 00000000 01200000 00000000 00000000 00000000 02000000 00000000 00000001 00000100 18000000 00000000 00400010 00000000 80000000 00000000 00000000 00000000 0006000a 00000000 00020400 |