On Target CXCR2_HUMAN 0.035460994/CHEMBL1784685
For the given ligand S protein, we have found in our database that, being scored 0.035460994, the most similar ligand is CHEMBL1784685. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL1784685 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | COc1ccc(cc1)c2ccn(c3ccc(C(=O)O)c(O)c3)c2c4ccc(cc4C)C(=O)N |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00006002 80000a09 20000108 d0090610 20001021 04026008 22240000 00081800 00100100 100008c0 10008084 60018008 81008812 00208200 21020041 880c200c 00020000 82802004 04200100 10620402 40100040 18028e20 30801000 8140000c 00040001 c0080040 08020200 00000850 0400c204 10060648 c0040a00 00000020 |