On Target 5HT7R_HUMAN 0.4939759/CHEMBL146942
For the given ligand CBD, we have found in our database that, being scored 0.4939759, the most similar ligand is CHEMBL146942. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL146942 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | NCCCC1(CCCN)CCc2cccc(O)c2C1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 43000008 20000102 00010600 00000000 40000002 02000000 00000201 00000800 000808c0 08100000 40018040 00000002 00200000 00000020 00002008 00000200 02000000 00002000 00020201 00000100 18000010 00004000 00400010 00000000 80000001 00000000 00000000 00000002 00064002 00020000 00000400 |