On Target 5HT4R_HUMAN 0.3206522/CHEMBL585567
For the given ligand CBDA, we have found in our database that, being scored 0.3206522, the most similar ligand is CHEMBL585567. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL585567 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | CO[C@@H]1CN(C[C@@H]2CCCC[C@@]2(O)c3cccc(O)c3)CC[C@@H]1NC(=O)c4cc(Cl)c(N)cc4OC |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 0000800a cb005e08 2010010a 80010700 00181080 40024100 06000000 22001400 00000900 001809e8 08300004 50018800 02008806 08a00000 81081441 000c2008 10000000 02000400 02c02000 00020601 40000100 180a8730 33000080 0050001c 00002001 c0000400 00900a00 90000001 00000302 0006081b e4060000 00022e00 |