On Target GASR_HUMAN 0.45544556/CHEMBL59234
For the given ligand Cilostazol, we have found in our database that, being scored 0.45544556, the most similar ligand is CHEMBL59234. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL59234 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | Cc1ccc2[C@@H](CC3CCCCC3)C[C@@H](NC(=O)Nc4cccc(c4)c5nn[nH]n5)C(=O)N(CC(=O)NC(C)(C)C)c2c1 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00014006 01003218 40100122 04010e00 24000000 00002048 03000004 20182009 00100900 080a0ad0 08390024 4001b800 0680b08a 08302001 80020040 000c200e 00248010 02400800 0a002008 00000201 40160100 38050610 2002a003 0250401a 00150000 80200080 10000010 10001080 08488006 0006000b a00a5280 28404600 |