On Target HRH2_HUMAN 0.39790577/CHEMBL246597
For the given ligand Cilostazol, we have found in our database that, being scored 0.39790577, the most similar ligand is CHEMBL246597. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL246597 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CN1C(=O)COc2ccc(CC3CCN(CCOc4cccc5nc(C)ccc45)CC3)cc12 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04006002 01000008 6010510a 10010602 840410a0 00000000 06040000 20000008 00520800 000808d0 083c0004 5001c000 00808802 00700800 010a1041 020c440c 10040000 82000004 08200000 00060201 45100100 18048608 32c02000 80508010 00040000 80000000 28120048 10000081 00408204 00060003 00040000 00240600 |